C19H24N4O3S — CID 18163866
N-[2-(cyclopropylamino)-2-oxoethyl]-6-(4-oxo-2-sulfanylidene-1H-quinazolin-3-yl)hexanamide (PubChem CID 18163866) has the molecular formula C19H24N4O3S and a molecular weight of 388.49 g/mol. Its IUPAC name is N-[2-(cyclopropylamino)-2-oxoethyl]-6-(4-oxo-2-sulfanylidene-1H-quinazolin-3-yl)hexanamide.
| Compound Name | N-[2-(cyclopropylamino)-2-oxoethyl]-6-(4-oxo-2-sulfanylidene-1H-quinazolin-3-yl)hexanamide |
|---|---|
| PubChem CID | 18163866 |
| Molecular Formula | C19H24N4O3S |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | N-[2-(cyclopropylamino)-2-oxoethyl]-6-(4-oxo-2-sulfanylidene-1H-quinazolin-3-yl)hexanamide |
| SMILES | O=C(CCCCCn1c(=S)[nH]c2ccccc2c1=O)NCC(=O)NC1CC1 |
| InChI | InChI=1S/C19H24N4O3S/c24-16(20-12-17(25)21-13-9-10-13)8-2-1-5-11-23-18(26)14-6-3-4-7-15(14)22-19(23)27/h3-4,6-7,13H,1-2,5,8-12H2,(H,20,24)(H,21,25)(H,22,27) |
| InChIKey | VMAMPJXUDVPWFE-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 95.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|