C24H26N4O3S — CID 26110972
N-cyclopropyl-3-[6-(4-oxo-2-sulfanylidene-1H-quinazolin-3-yl)hexanoylamino]benzamide (PubChem CID 26110972) has the molecular formula C24H26N4O3S and a molecular weight of 450.56 g/mol. Its IUPAC name is N-cyclopropyl-3-[6-(4-oxo-2-sulfanylidene-1H-quinazolin-3-yl)hexanoylamino]benzamide.
| Compound Name | N-cyclopropyl-3-[6-(4-oxo-2-sulfanylidene-1H-quinazolin-3-yl)hexanoylamino]benzamide |
|---|---|
| PubChem CID | 26110972 |
| Molecular Formula | C24H26N4O3S |
| Molecular Weight | 450.56 g/mol |
| Exact Mass | 450.17 |
| IUPAC Name | N-cyclopropyl-3-[6-(4-oxo-2-sulfanylidene-1H-quinazolin-3-yl)hexanoylamino]benzamide |
| SMILES | O=C(CCCCCn1c(=S)[nH]c2ccccc2c1=O)Nc1cccc(C(=O)NC2CC2)c1 |
| InChI | InChI=1S/C24H26N4O3S/c29-21(25-18-8-6-7-16(15-18)22(30)26-17-12-13-17)11-2-1-5-14-28-23(31)19-9-3-4-10-20(19)27-24(28)32/h3-4,6-10,15,17H,1-2,5,11-14H2,(H,25,29)(H,26,30)(H,27,32) |
| InChIKey | RFBCJJQXDUFKHN-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 95.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.56 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|