C26H26N4O2S — CID 112803513
6-(4-oxo-2-sulfanylidene-1H-quinazolin-3-yl)-N-[4-(pyridin-4-ylmethyl)phenyl]hexanamide (PubChem CID 112803513) has the molecular formula C26H26N4O2S and a molecular weight of 458.59 g/mol. Its IUPAC name is 6-(4-oxo-2-sulfanylidene-1H-quinazolin-3-yl)-N-[4-(pyridin-4-ylmethyl)phenyl]hexanamide.
| Compound Name | 6-(4-oxo-2-sulfanylidene-1H-quinazolin-3-yl)-N-[4-(pyridin-4-ylmethyl)phenyl]hexanamide |
|---|---|
| PubChem CID | 112803513 |
| Molecular Formula | C26H26N4O2S |
| Molecular Weight | 458.59 g/mol |
| Exact Mass | 458.18 |
| IUPAC Name | 6-(4-oxo-2-sulfanylidene-1H-quinazolin-3-yl)-N-[4-(pyridin-4-ylmethyl)phenyl]hexanamide |
| SMILES | O=C(CCCCCn1c(=S)[nH]c2ccccc2c1=O)Nc1ccc(Cc2ccncc2)cc1 |
| InChI | InChI=1S/C26H26N4O2S/c31-24(28-21-11-9-19(10-12-21)18-20-13-15-27-16-14-20)8-2-1-5-17-30-25(32)22-6-3-4-7-23(22)29-26(30)33/h3-4,6-7,9-16H,1-2,5,8,17-18H2,(H,28,31)(H,29,33) |
| InChIKey | YPAKEDURIZABDC-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 79.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.59 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|