C25H27N5O2S — CID 26081869
6-(4-oxo-2-sulfanylidene-1H-quinazolin-3-yl)-N-[2-(4-pyrazol-1-ylphenyl)ethyl]hexanamide (PubChem CID 26081869) has the molecular formula C25H27N5O2S and a molecular weight of 461.59 g/mol. Its IUPAC name is 6-(4-oxo-2-sulfanylidene-1H-quinazolin-3-yl)-N-[2-(4-pyrazol-1-ylphenyl)ethyl]hexanamide.
| Compound Name | 6-(4-oxo-2-sulfanylidene-1H-quinazolin-3-yl)-N-[2-(4-pyrazol-1-ylphenyl)ethyl]hexanamide |
|---|---|
| PubChem CID | 26081869 |
| Molecular Formula | C25H27N5O2S |
| Molecular Weight | 461.59 g/mol |
| Exact Mass | 461.19 |
| IUPAC Name | 6-(4-oxo-2-sulfanylidene-1H-quinazolin-3-yl)-N-[2-(4-pyrazol-1-ylphenyl)ethyl]hexanamide |
| SMILES | O=C(CCCCCn1c(=S)[nH]c2ccccc2c1=O)NCCc1ccc(-n2cccn2)cc1 |
| InChI | InChI=1S/C25H27N5O2S/c31-23(26-16-14-19-10-12-20(13-11-19)30-18-6-15-27-30)9-2-1-5-17-29-24(32)21-7-3-4-8-22(21)28-25(29)33/h3-4,6-8,10-13,15,18H,1-2,5,9,14,16-17H2,(H,26,31)(H,28,33) |
| InChIKey | QFSXEWFGDGDXGC-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.59 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|