C13H15N3O2S — CID 106236215
5-(4-oxo-2-sulfanylidene-1H-quinazolin-3-yl)pentanamide (PubChem CID 106236215) has the molecular formula C13H15N3O2S and a molecular weight of 277.35 g/mol. Its IUPAC name is 5-(4-oxo-2-sulfanylidene-1H-quinazolin-3-yl)pentanamide.
| Compound Name | 5-(4-oxo-2-sulfanylidene-1H-quinazolin-3-yl)pentanamide |
|---|---|
| PubChem CID | 106236215 |
| Molecular Formula | C13H15N3O2S |
| Molecular Weight | 277.35 g/mol |
| Exact Mass | 277.09 |
| IUPAC Name | 5-(4-oxo-2-sulfanylidene-1H-quinazolin-3-yl)pentanamide |
| SMILES | NC(=O)CCCCn1c(=S)[nH]c2ccccc2c1=O |
| InChI | InChI=1S/C13H15N3O2S/c14-11(17)7-3-4-8-16-12(18)9-5-1-2-6-10(9)15-13(16)19/h1-2,5-6H,3-4,7-8H2,(H2,14,17)(H,15,19) |
| InChIKey | OEVACGQGKUKRRU-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 80.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.35 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|