C13H16N2O2S — CID 127038710
3-(5-hydroxypentyl)-2-sulfanylidene-1H-quinazolin-4-one (PubChem CID 127038710) has the molecular formula C13H16N2O2S and a molecular weight of 264.35 g/mol. Its IUPAC name is 3-(5-hydroxypentyl)-2-sulfanylidene-1H-quinazolin-4-one.
| Compound Name | 3-(5-hydroxypentyl)-2-sulfanylidene-1H-quinazolin-4-one |
|---|---|
| PubChem CID | 127038710 |
| Molecular Formula | C13H16N2O2S |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | 3-(5-hydroxypentyl)-2-sulfanylidene-1H-quinazolin-4-one |
| SMILES | O=c1c2ccccc2[nH]c(=S)n1CCCCCO |
| InChI | InChI=1S/C13H16N2O2S/c16-9-5-1-4-8-15-12(17)10-6-2-3-7-11(10)14-13(15)18/h2-3,6-7,16H,1,4-5,8-9H2,(H,14,18) |
| InChIKey | CWJRHUZNHMQUPX-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 58.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|