C12H11N2O3S- — CID 3441231
4-(4-oxo-2-sulfanylidene-1H-quinazolin-3-yl)butanoate (PubChem CID 3441231) has the molecular formula C12H11N2O3S- and a molecular weight of 263.30 g/mol. Its IUPAC name is 4-(4-oxo-2-sulfanylidene-1H-quinazolin-3-yl)butanoate.
| Compound Name | 4-(4-oxo-2-sulfanylidene-1H-quinazolin-3-yl)butanoate |
|---|---|
| PubChem CID | 3441231 |
| Molecular Formula | C12H11N2O3S- |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.05 |
| IUPAC Name | 4-(4-oxo-2-sulfanylidene-1H-quinazolin-3-yl)butanoate |
| SMILES | O=C([O-])CCCn1c(=S)[nH]c2ccccc2c1=O |
| InChI | InChI=1S/C12H12N2O3S/c15-10(16)6-3-7-14-11(17)8-4-1-2-5-9(8)13-12(14)18/h1-2,4-5H,3,6-7H2,(H,13,18)(H,15,16)/p-1 |
| InChIKey | MSINSMOFQBHROJ-UHFFFAOYSA-M |
| XLogP | 0.59 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|