C21H22N4O4S — CID 46652877
2-hydroxy-N'-[6-(4-oxo-2-sulfanylidene-1H-quinazolin-3-yl)hexanoyl]benzohydrazide (PubChem CID 46652877) has the molecular formula C21H22N4O4S and a molecular weight of 426.50 g/mol. Its IUPAC name is 2-hydroxy-N'-[6-(4-oxo-2-sulfanylidene-1H-quinazolin-3-yl)hexanoyl]benzohydrazide.
| Compound Name | 2-hydroxy-N'-[6-(4-oxo-2-sulfanylidene-1H-quinazolin-3-yl)hexanoyl]benzohydrazide |
|---|---|
| PubChem CID | 46652877 |
| Molecular Formula | C21H22N4O4S |
| Molecular Weight | 426.50 g/mol |
| Exact Mass | 426.14 |
| IUPAC Name | 2-hydroxy-N'-[6-(4-oxo-2-sulfanylidene-1H-quinazolin-3-yl)hexanoyl]benzohydrazide |
| SMILES | O=C(CCCCCn1c(=S)[nH]c2ccccc2c1=O)NNC(=O)c1ccccc1O |
| InChI | InChI=1S/C21H22N4O4S/c26-17-11-6-4-9-15(17)19(28)24-23-18(27)12-2-1-7-13-25-20(29)14-8-3-5-10-16(14)22-21(25)30/h3-6,8-11,26H,1-2,7,12-13H2,(H,22,30)(H,23,27)(H,24,28) |
| InChIKey | SBNUWVQSHGITQA-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 116.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.50 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|