C21H23N3O5S — CID 4091041
4-(4-oxo-2-sulfanylidene-1H-quinazolin-3-yl)-N-(3,4,5-trimethoxyphenyl)butanamide (PubChem CID 4091041) has the molecular formula C21H23N3O5S and a molecular weight of 429.50 g/mol. Its IUPAC name is 4-(4-oxo-2-sulfanylidene-1H-quinazolin-3-yl)-N-(3,4,5-trimethoxyphenyl)butanamide.
| Compound Name | 4-(4-oxo-2-sulfanylidene-1H-quinazolin-3-yl)-N-(3,4,5-trimethoxyphenyl)butanamide |
|---|---|
| PubChem CID | 4091041 |
| Molecular Formula | C21H23N3O5S |
| Molecular Weight | 429.50 g/mol |
| Exact Mass | 429.14 |
| IUPAC Name | 4-(4-oxo-2-sulfanylidene-1H-quinazolin-3-yl)-N-(3,4,5-trimethoxyphenyl)butanamide |
| SMILES | COc1cc(NC(=O)CCCn2c(=S)[nH]c3ccccc3c2=O)cc(OC)c1OC |
| InChI | InChI=1S/C21H23N3O5S/c1-27-16-11-13(12-17(28-2)19(16)29-3)22-18(25)9-6-10-24-20(26)14-7-4-5-8-15(14)23-21(24)30/h4-5,7-8,11-12H,6,9-10H2,1-3H3,(H,22,25)(H,23,30) |
| InChIKey | ZHUWYXRSOFOAKE-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 94.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.50 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|