C19H24BrN3O2S — CID 4225067
4-(6-bromo-4-oxo-2-sulfanylidene-1H-quinazolin-3-yl)-N-(4-methylcyclohexyl)butanamide (PubChem CID 4225067) has the molecular formula C19H24BrN3O2S and a molecular weight of 438.39 g/mol. Its IUPAC name is 4-(6-bromo-4-oxo-2-sulfanylidene-1H-quinazolin-3-yl)-N-(4-methylcyclohexyl)butanamide.
| Compound Name | 4-(6-bromo-4-oxo-2-sulfanylidene-1H-quinazolin-3-yl)-N-(4-methylcyclohexyl)butanamide |
|---|---|
| PubChem CID | 4225067 |
| Molecular Formula | C19H24BrN3O2S |
| Molecular Weight | 438.39 g/mol |
| Exact Mass | 437.08 |
| IUPAC Name | 4-(6-bromo-4-oxo-2-sulfanylidene-1H-quinazolin-3-yl)-N-(4-methylcyclohexyl)butanamide |
| SMILES | CC1CCC(NC(=O)CCCn2c(=S)[nH]c3ccc(Br)cc3c2=O)CC1 |
| InChI | InChI=1S/C19H24BrN3O2S/c1-12-4-7-14(8-5-12)21-17(24)3-2-10-23-18(25)15-11-13(20)6-9-16(15)22-19(23)26/h6,9,11-12,14H,2-5,7-8,10H2,1H3,(H,21,24)(H,22,26) |
| InChIKey | YYNCTGWZJXNDAJ-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 66.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.39 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|