C20H29BrN4O2S — CID 5111170
6-(6-bromo-4-oxo-2-sulfanylidene-1H-quinazolin-3-yl)-N-[2-(diethylamino)ethyl]hexanamide (PubChem CID 5111170) has the molecular formula C20H29BrN4O2S and a molecular weight of 469.45 g/mol. Its IUPAC name is 6-(6-bromo-4-oxo-2-sulfanylidene-1H-quinazolin-3-yl)-N-[2-(diethylamino)ethyl]hexanamide.
| Compound Name | 6-(6-bromo-4-oxo-2-sulfanylidene-1H-quinazolin-3-yl)-N-[2-(diethylamino)ethyl]hexanamide |
|---|---|
| PubChem CID | 5111170 |
| Molecular Formula | C20H29BrN4O2S |
| Molecular Weight | 469.45 g/mol |
| Exact Mass | 468.12 |
| IUPAC Name | 6-(6-bromo-4-oxo-2-sulfanylidene-1H-quinazolin-3-yl)-N-[2-(diethylamino)ethyl]hexanamide |
| SMILES | CCN(CC)CCNC(=O)CCCCCn1c(=S)[nH]c2ccc(Br)cc2c1=O |
| InChI | InChI=1S/C20H29BrN4O2S/c1-3-24(4-2)13-11-22-18(26)8-6-5-7-12-25-19(27)16-14-15(21)9-10-17(16)23-20(25)28/h9-10,14H,3-8,11-13H2,1-2H3,(H,22,26)(H,23,28) |
| InChIKey | OOZVTRWDNBUWCF-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 70.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.45 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|