C20H30BrN4O2S+ — CID 5111169
2-[6-(6-bromo-4-oxo-2-sulfanylidene-1H-quinazolin-3-yl)hexanoylamino]ethyl-diethylazanium (PubChem CID 5111169) has the molecular formula C20H30BrN4O2S+ and a molecular weight of 470.46 g/mol. Its IUPAC name is 2-[6-(6-bromo-4-oxo-2-sulfanylidene-1H-quinazolin-3-yl)hexanoylamino]ethyl-diethylazanium.
| Compound Name | 2-[6-(6-bromo-4-oxo-2-sulfanylidene-1H-quinazolin-3-yl)hexanoylamino]ethyl-diethylazanium |
|---|---|
| PubChem CID | 5111169 |
| Molecular Formula | C20H30BrN4O2S+ |
| Molecular Weight | 470.46 g/mol |
| Exact Mass | 469.13 |
| IUPAC Name | 2-[6-(6-bromo-4-oxo-2-sulfanylidene-1H-quinazolin-3-yl)hexanoylamino]ethyl-diethylazanium |
| SMILES | CC[NH+](CC)CCNC(=O)CCCCCn1c(=S)[nH]c2ccc(Br)cc2c1=O |
| InChI | InChI=1S/C20H29BrN4O2S/c1-3-24(4-2)13-11-22-18(26)8-6-5-7-12-25-19(27)16-14-15(21)9-10-17(16)23-20(25)28/h9-10,14H,3-8,11-13H2,1-2H3,(H,22,26)(H,23,28)/p+1 |
| InChIKey | OOZVTRWDNBUWCF-UHFFFAOYSA-O |
| XLogP | 2.42 |
| TPSA | 71.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.46 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|