C18H27N4O2S+ — CID 3426133
diethyl-[2-[(4-oxo-3-propyl-2-sulfanylidene-1H-quinazoline-7-carbonyl)amino]ethyl]azanium (PubChem CID 3426133) has the molecular formula C18H27N4O2S+ and a molecular weight of 363.51 g/mol. Its IUPAC name is diethyl-[2-[(4-oxo-3-propyl-2-sulfanylidene-1H-quinazoline-7-carbonyl)amino]ethyl]azanium.
| Compound Name | diethyl-[2-[(4-oxo-3-propyl-2-sulfanylidene-1H-quinazoline-7-carbonyl)amino]ethyl]azanium |
|---|---|
| PubChem CID | 3426133 |
| Molecular Formula | C18H27N4O2S+ |
| Molecular Weight | 363.51 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | diethyl-[2-[(4-oxo-3-propyl-2-sulfanylidene-1H-quinazoline-7-carbonyl)amino]ethyl]azanium |
| SMILES | CCCn1c(=S)[nH]c2cc(C(=O)NCC[NH+](CC)CC)ccc2c1=O |
| InChI | InChI=1S/C18H26N4O2S/c1-4-10-22-17(24)14-8-7-13(12-15(14)20-18(22)25)16(23)19-9-11-21(5-2)6-3/h7-8,12H,4-6,9-11H2,1-3H3,(H,19,23)(H,20,25)/p+1 |
| InChIKey | OPXLNLIEYIQNKP-UHFFFAOYSA-O |
| XLogP | 1.12 |
| TPSA | 71.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.51 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|