C19H27N4O3S+ — CID 5071318
diethyl-[2-[7-(morpholine-4-carbonyl)-4-oxo-2-sulfanylidene-1H-quinazolin-3-yl]ethyl]azanium (PubChem CID 5071318) has the molecular formula C19H27N4O3S+ and a molecular weight of 391.52 g/mol. Its IUPAC name is diethyl-[2-[7-(morpholine-4-carbonyl)-4-oxo-2-sulfanylidene-1H-quinazolin-3-yl]ethyl]azanium.
| Compound Name | diethyl-[2-[7-(morpholine-4-carbonyl)-4-oxo-2-sulfanylidene-1H-quinazolin-3-yl]ethyl]azanium |
|---|---|
| PubChem CID | 5071318 |
| Molecular Formula | C19H27N4O3S+ |
| Molecular Weight | 391.52 g/mol |
| Exact Mass | 391.18 |
| IUPAC Name | diethyl-[2-[7-(morpholine-4-carbonyl)-4-oxo-2-sulfanylidene-1H-quinazolin-3-yl]ethyl]azanium |
| SMILES | CC[NH+](CC)CCn1c(=S)[nH]c2cc(C(=O)N3CCOCC3)ccc2c1=O |
| InChI | InChI=1S/C19H26N4O3S/c1-3-21(4-2)7-8-23-18(25)15-6-5-14(13-16(15)20-19(23)27)17(24)22-9-11-26-12-10-22/h5-6,13H,3-4,7-12H2,1-2H3,(H,20,27)/p+1 |
| InChIKey | UDRMBMKEPDPRNT-UHFFFAOYSA-O |
| XLogP | 0.46 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.52 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|