C20H21N5O2S — CID 39640964
3-ethyl-7-(4-pyridin-4-ylpiperazine-1-carbonyl)-2-sulfanylidene-1H-quinazolin-4-one (PubChem CID 39640964) has the molecular formula C20H21N5O2S and a molecular weight of 395.49 g/mol. Its IUPAC name is 3-ethyl-7-(4-pyridin-4-ylpiperazine-1-carbonyl)-2-sulfanylidene-1H-quinazolin-4-one.
| Compound Name | 3-ethyl-7-(4-pyridin-4-ylpiperazine-1-carbonyl)-2-sulfanylidene-1H-quinazolin-4-one |
|---|---|
| PubChem CID | 39640964 |
| Molecular Formula | C20H21N5O2S |
| Molecular Weight | 395.49 g/mol |
| Exact Mass | 395.14 |
| IUPAC Name | 3-ethyl-7-(4-pyridin-4-ylpiperazine-1-carbonyl)-2-sulfanylidene-1H-quinazolin-4-one |
| SMILES | CCn1c(=S)[nH]c2cc(C(=O)N3CCN(c4ccncc4)CC3)ccc2c1=O |
| InChI | InChI=1S/C20H21N5O2S/c1-2-25-19(27)16-4-3-14(13-17(16)22-20(25)28)18(26)24-11-9-23(10-12-24)15-5-7-21-8-6-15/h3-8,13H,2,9-12H2,1H3,(H,22,28) |
| InChIKey | LVAZPDWAJDZVRN-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 74.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.49 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|