C22H23N5O2S — CID 35856876
3-prop-2-enyl-7-[4-(pyridin-4-ylmethyl)piperazine-1-carbonyl]-2-sulfanylidene-1H-quinazolin-4-one (PubChem CID 35856876) has the molecular formula C22H23N5O2S and a molecular weight of 421.53 g/mol. Its IUPAC name is 3-prop-2-enyl-7-[4-(pyridin-4-ylmethyl)piperazine-1-carbonyl]-2-sulfanylidene-1H-quinazolin-4-one.
| Compound Name | 3-prop-2-enyl-7-[4-(pyridin-4-ylmethyl)piperazine-1-carbonyl]-2-sulfanylidene-1H-quinazolin-4-one |
|---|---|
| PubChem CID | 35856876 |
| Molecular Formula | C22H23N5O2S |
| Molecular Weight | 421.53 g/mol |
| Exact Mass | 421.16 |
| IUPAC Name | 3-prop-2-enyl-7-[4-(pyridin-4-ylmethyl)piperazine-1-carbonyl]-2-sulfanylidene-1H-quinazolin-4-one |
| SMILES | C=CCn1c(=S)[nH]c2cc(C(=O)N3CCN(Cc4ccncc4)CC3)ccc2c1=O |
| InChI | InChI=1S/C22H23N5O2S/c1-2-9-27-21(29)18-4-3-17(14-19(18)24-22(27)30)20(28)26-12-10-25(11-13-26)15-16-5-7-23-8-6-16/h2-8,14H,1,9-13,15H2,(H,24,30) |
| InChIKey | KLRZEYPTGRCDSM-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 74.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.53 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|