C18H21N3O2S — CID 46651037
7-(3-methylpiperidine-1-carbonyl)-3-prop-2-enyl-2-sulfanylidene-1H-quinazolin-4-one (PubChem CID 46651037) has the molecular formula C18H21N3O2S and a molecular weight of 343.45 g/mol. Its IUPAC name is 7-(3-methylpiperidine-1-carbonyl)-3-prop-2-enyl-2-sulfanylidene-1H-quinazolin-4-one.
| Compound Name | 7-(3-methylpiperidine-1-carbonyl)-3-prop-2-enyl-2-sulfanylidene-1H-quinazolin-4-one |
|---|---|
| PubChem CID | 46651037 |
| Molecular Formula | C18H21N3O2S |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | 7-(3-methylpiperidine-1-carbonyl)-3-prop-2-enyl-2-sulfanylidene-1H-quinazolin-4-one |
| SMILES | C=CCn1c(=S)[nH]c2cc(C(=O)N3CCCC(C)C3)ccc2c1=O |
| InChI | InChI=1S/C18H21N3O2S/c1-3-8-21-17(23)14-7-6-13(10-15(14)19-18(21)24)16(22)20-9-4-5-12(2)11-20/h3,6-7,10,12H,1,4-5,8-9,11H2,2H3,(H,19,24) |
| InChIKey | RTQWQSKKGRJKSB-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 58.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|