C24H22N4O2S2 — CID 27782553
7-[4-(1,3-benzothiazol-2-yl)piperidine-1-carbonyl]-3-prop-2-enyl-2-sulfanylidene-1H-quinazolin-4-one (PubChem CID 27782553) has the molecular formula C24H22N4O2S2 and a molecular weight of 462.60 g/mol. Its IUPAC name is 7-[4-(1,3-benzothiazol-2-yl)piperidine-1-carbonyl]-3-prop-2-enyl-2-sulfanylidene-1H-quinazolin-4-one.
| Compound Name | 7-[4-(1,3-benzothiazol-2-yl)piperidine-1-carbonyl]-3-prop-2-enyl-2-sulfanylidene-1H-quinazolin-4-one |
|---|---|
| PubChem CID | 27782553 |
| Molecular Formula | C24H22N4O2S2 |
| Molecular Weight | 462.60 g/mol |
| Exact Mass | 462.12 |
| IUPAC Name | 7-[4-(1,3-benzothiazol-2-yl)piperidine-1-carbonyl]-3-prop-2-enyl-2-sulfanylidene-1H-quinazolin-4-one |
| SMILES | C=CCn1c(=S)[nH]c2cc(C(=O)N3CCC(c4nc5ccccc5s4)CC3)ccc2c1=O |
| InChI | InChI=1S/C24H22N4O2S2/c1-2-11-28-23(30)17-8-7-16(14-19(17)26-24(28)31)22(29)27-12-9-15(10-13-27)21-25-18-5-3-4-6-20(18)32-21/h2-8,14-15H,1,9-13H2,(H,26,31) |
| InChIKey | CRRYGUVZJNSWPY-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 70.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.60 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|