C21H19N3O3S — CID 30496869
7-[4-(1,3-benzothiazol-2-yl)piperidine-1-carbonyl]-4H-1,4-benzoxazin-3-one (PubChem CID 30496869) has the molecular formula C21H19N3O3S and a molecular weight of 393.47 g/mol. Its IUPAC name is 7-[4-(1,3-benzothiazol-2-yl)piperidine-1-carbonyl]-4H-1,4-benzoxazin-3-one.
| Compound Name | 7-[4-(1,3-benzothiazol-2-yl)piperidine-1-carbonyl]-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 30496869 |
| Molecular Formula | C21H19N3O3S |
| Molecular Weight | 393.47 g/mol |
| Exact Mass | 393.11 |
| IUPAC Name | 7-[4-(1,3-benzothiazol-2-yl)piperidine-1-carbonyl]-4H-1,4-benzoxazin-3-one |
| SMILES | O=C1COc2cc(C(=O)N3CCC(c4nc5ccccc5s4)CC3)ccc2N1 |
| InChI | InChI=1S/C21H19N3O3S/c25-19-12-27-17-11-14(5-6-15(17)22-19)21(26)24-9-7-13(8-10-24)20-23-16-3-1-2-4-18(16)28-20/h1-6,11,13H,7-10,12H2,(H,22,25) |
| InChIKey | CRUTUZXNYKOLMV-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.47 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |