C20H23N3O4S — CID 27555107
ethyl 1-(4-oxo-3-prop-2-enyl-2-sulfanylidene-1H-quinazoline-7-carbonyl)piperidine-4-carboxylate (PubChem CID 27555107) has the molecular formula C20H23N3O4S and a molecular weight of 401.49 g/mol. Its IUPAC name is ethyl 1-(4-oxo-3-prop-2-enyl-2-sulfanylidene-1H-quinazoline-7-carbonyl)piperidine-4-carboxylate.
| Compound Name | ethyl 1-(4-oxo-3-prop-2-enyl-2-sulfanylidene-1H-quinazoline-7-carbonyl)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 27555107 |
| Molecular Formula | C20H23N3O4S |
| Molecular Weight | 401.49 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | ethyl 1-(4-oxo-3-prop-2-enyl-2-sulfanylidene-1H-quinazoline-7-carbonyl)piperidine-4-carboxylate |
| SMILES | C=CCn1c(=S)[nH]c2cc(C(=O)N3CCC(C(=O)OCC)CC3)ccc2c1=O |
| InChI | InChI=1S/C20H23N3O4S/c1-3-9-23-18(25)15-6-5-14(12-16(15)21-20(23)28)17(24)22-10-7-13(8-11-22)19(26)27-4-2/h3,5-6,12-13H,1,4,7-11H2,2H3,(H,21,28) |
| InChIKey | ZMCSCNLWDQPMKI-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 84.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.49 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|