C24H31N3O4S — CID 15995417
ethyl 1-[4-[(4-oxo-2-sulfanylidene-1H-quinazolin-3-yl)methyl]cyclohexanecarbonyl]piperidine-4-carboxylate (PubChem CID 15995417) has the molecular formula C24H31N3O4S and a molecular weight of 457.60 g/mol. Its IUPAC name is ethyl 1-[4-[(4-oxo-2-sulfanylidene-1H-quinazolin-3-yl)methyl]cyclohexanecarbonyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[4-[(4-oxo-2-sulfanylidene-1H-quinazolin-3-yl)methyl]cyclohexanecarbonyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 15995417 |
| Molecular Formula | C24H31N3O4S |
| Molecular Weight | 457.60 g/mol |
| Exact Mass | 457.20 |
| IUPAC Name | ethyl 1-[4-[(4-oxo-2-sulfanylidene-1H-quinazolin-3-yl)methyl]cyclohexanecarbonyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(C(=O)C2CCC(Cn3c(=S)[nH]c4ccccc4c3=O)CC2)CC1 |
| InChI | InChI=1S/C24H31N3O4S/c1-2-31-23(30)18-11-13-26(14-12-18)21(28)17-9-7-16(8-10-17)15-27-22(29)19-5-3-4-6-20(19)25-24(27)32/h3-6,16-18H,2,7-15H2,1H3,(H,25,32) |
| InChIKey | YEJSXZGHWVNREJ-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 84.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.60 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|