C23H29N5O3S — CID 55702436
7-[4-(4-methylpiperazine-1-carbonyl)piperidine-1-carbonyl]-3-prop-2-enyl-2-sulfanylidene-1H-quinazolin-4-one (PubChem CID 55702436) has the molecular formula C23H29N5O3S and a molecular weight of 455.58 g/mol. Its IUPAC name is 7-[4-(4-methylpiperazine-1-carbonyl)piperidine-1-carbonyl]-3-prop-2-enyl-2-sulfanylidene-1H-quinazolin-4-one.
| Compound Name | 7-[4-(4-methylpiperazine-1-carbonyl)piperidine-1-carbonyl]-3-prop-2-enyl-2-sulfanylidene-1H-quinazolin-4-one |
|---|---|
| PubChem CID | 55702436 |
| Molecular Formula | C23H29N5O3S |
| Molecular Weight | 455.58 g/mol |
| Exact Mass | 455.20 |
| IUPAC Name | 7-[4-(4-methylpiperazine-1-carbonyl)piperidine-1-carbonyl]-3-prop-2-enyl-2-sulfanylidene-1H-quinazolin-4-one |
| SMILES | C=CCn1c(=S)[nH]c2cc(C(=O)N3CCC(C(=O)N4CCN(C)CC4)CC3)ccc2c1=O |
| InChI | InChI=1S/C23H29N5O3S/c1-3-8-28-22(31)18-5-4-17(15-19(18)24-23(28)32)21(30)26-9-6-16(7-10-26)20(29)27-13-11-25(2)12-14-27/h3-5,15-16H,1,6-14H2,2H3,(H,24,32) |
| InChIKey | BOYGXCZFRVRGAF-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.58 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|