C21H21ClN4O2S — CID 31936059
7-[4-(3-chlorophenyl)piperazine-1-carbonyl]-3-ethyl-2-sulfanylidene-1H-quinazolin-4-one (PubChem CID 31936059) has the molecular formula C21H21ClN4O2S and a molecular weight of 428.95 g/mol. Its IUPAC name is 7-[4-(3-chlorophenyl)piperazine-1-carbonyl]-3-ethyl-2-sulfanylidene-1H-quinazolin-4-one.
| Compound Name | 7-[4-(3-chlorophenyl)piperazine-1-carbonyl]-3-ethyl-2-sulfanylidene-1H-quinazolin-4-one |
|---|---|
| PubChem CID | 31936059 |
| Molecular Formula | C21H21ClN4O2S |
| Molecular Weight | 428.95 g/mol |
| Exact Mass | 428.11 |
| IUPAC Name | 7-[4-(3-chlorophenyl)piperazine-1-carbonyl]-3-ethyl-2-sulfanylidene-1H-quinazolin-4-one |
| SMILES | CCn1c(=S)[nH]c2cc(C(=O)N3CCN(c4cccc(Cl)c4)CC3)ccc2c1=O |
| InChI | InChI=1S/C21H21ClN4O2S/c1-2-26-20(28)17-7-6-14(12-18(17)23-21(26)29)19(27)25-10-8-24(9-11-25)16-5-3-4-15(22)13-16/h3-7,12-13H,2,8-11H2,1H3,(H,23,29) |
| InChIKey | UPPHGQNEHXXUDI-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 61.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.95 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|