C26H32N4O5 — CID 46369052
3-[3-(4-benzylpiperazin-1-yl)-3-oxopropyl]-6,7-diethoxy-1H-quinazoline-2,4-dione (PubChem CID 46369052) has the molecular formula C26H32N4O5 and a molecular weight of 480.57 g/mol. Its IUPAC name is 3-[3-(4-benzylpiperazin-1-yl)-3-oxopropyl]-6,7-diethoxy-1H-quinazoline-2,4-dione.
| Compound Name | 3-[3-(4-benzylpiperazin-1-yl)-3-oxopropyl]-6,7-diethoxy-1H-quinazoline-2,4-dione |
|---|---|
| PubChem CID | 46369052 |
| Molecular Formula | C26H32N4O5 |
| Molecular Weight | 480.57 g/mol |
| Exact Mass | 480.24 |
| IUPAC Name | 3-[3-(4-benzylpiperazin-1-yl)-3-oxopropyl]-6,7-diethoxy-1H-quinazoline-2,4-dione |
| SMILES | CCOc1cc2[nH]c(=O)n(CCC(=O)N3CCN(Cc4ccccc4)CC3)c(=O)c2cc1OCC |
| InChI | InChI=1S/C26H32N4O5/c1-3-34-22-16-20-21(17-23(22)35-4-2)27-26(33)30(25(20)32)11-10-24(31)29-14-12-28(13-15-29)18-19-8-6-5-7-9-19/h5-9,16-17H,3-4,10-15,18H2,1-2H3,(H,27,33) |
| InChIKey | VSTKBNNUXIOJFL-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 96.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.57 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |