C26H31ClN4O5 — CID 22423344
3-[6-[4-(3-chlorophenyl)piperazin-1-yl]-6-oxohexyl]-6,7-dimethoxy-1H-quinazoline-2,4-dione (PubChem CID 22423344) has the molecular formula C26H31ClN4O5 and a molecular weight of 515.01 g/mol. Its IUPAC name is 3-[6-[4-(3-chlorophenyl)piperazin-1-yl]-6-oxohexyl]-6,7-dimethoxy-1H-quinazoline-2,4-dione.
| Compound Name | 3-[6-[4-(3-chlorophenyl)piperazin-1-yl]-6-oxohexyl]-6,7-dimethoxy-1H-quinazoline-2,4-dione |
|---|---|
| PubChem CID | 22423344 |
| Molecular Formula | C26H31ClN4O5 |
| Molecular Weight | 515.01 g/mol |
| Exact Mass | 514.20 |
| IUPAC Name | 3-[6-[4-(3-chlorophenyl)piperazin-1-yl]-6-oxohexyl]-6,7-dimethoxy-1H-quinazoline-2,4-dione |
| SMILES | COc1cc2[nH]c(=O)n(CCCCCC(=O)N3CCN(c4cccc(Cl)c4)CC3)c(=O)c2cc1OC |
| InChI | InChI=1S/C26H31ClN4O5/c1-35-22-16-20-21(17-23(22)36-2)28-26(34)31(25(20)33)10-5-3-4-9-24(32)30-13-11-29(12-14-30)19-8-6-7-18(27)15-19/h6-8,15-17H,3-5,9-14H2,1-2H3,(H,28,34) |
| InChIKey | BKKKZOCUVROKPW-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 96.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.01 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|