C18H23N3O3 — CID 4905579
3-[4-(azepan-1-yl)-4-oxobutyl]-1H-quinazoline-2,4-dione (PubChem CID 4905579) has the molecular formula C18H23N3O3 and a molecular weight of 329.40 g/mol. Its IUPAC name is 3-[4-(azepan-1-yl)-4-oxobutyl]-1H-quinazoline-2,4-dione.
| Compound Name | 3-[4-(azepan-1-yl)-4-oxobutyl]-1H-quinazoline-2,4-dione |
|---|---|
| PubChem CID | 4905579 |
| Molecular Formula | C18H23N3O3 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | 3-[4-(azepan-1-yl)-4-oxobutyl]-1H-quinazoline-2,4-dione |
| SMILES | O=C(CCCn1c(=O)[nH]c2ccccc2c1=O)N1CCCCCC1 |
| InChI | InChI=1S/C18H23N3O3/c22-16(20-11-5-1-2-6-12-20)10-7-13-21-17(23)14-8-3-4-9-15(14)19-18(21)24/h3-4,8-9H,1-2,5-7,10-13H2,(H,19,24) |
| InChIKey | MFXGILDSVPAUHB-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 75.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |