C19H26N4O2 — CID 4911322
3-[6-(azepan-1-yl)-6-oxohexyl]-1,2,3-benzotriazin-4-one (PubChem CID 4911322) has the molecular formula C19H26N4O2 and a molecular weight of 342.44 g/mol. Its IUPAC name is 3-[6-(azepan-1-yl)-6-oxohexyl]-1,2,3-benzotriazin-4-one.
| Compound Name | 3-[6-(azepan-1-yl)-6-oxohexyl]-1,2,3-benzotriazin-4-one |
|---|---|
| PubChem CID | 4911322 |
| Molecular Formula | C19H26N4O2 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.21 |
| IUPAC Name | 3-[6-(azepan-1-yl)-6-oxohexyl]-1,2,3-benzotriazin-4-one |
| SMILES | O=C(CCCCCn1nnc2ccccc2c1=O)N1CCCCCC1 |
| InChI | InChI=1S/C19H26N4O2/c24-18(22-13-7-1-2-8-14-22)12-4-3-9-15-23-19(25)16-10-5-6-11-17(16)20-21-23/h5-6,10-11H,1-4,7-9,12-15H2 |
| InChIKey | MQTCXINCCQXYIM-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 68.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|