C11H10N3O3- — CID 7061910
4-(4-oxo-1,2,3-benzotriazin-3-yl)butanoate (PubChem CID 7061910) has the molecular formula C11H10N3O3- and a molecular weight of 232.22 g/mol. Its IUPAC name is 4-(4-oxo-1,2,3-benzotriazin-3-yl)butanoate.
| Compound Name | 4-(4-oxo-1,2,3-benzotriazin-3-yl)butanoate |
|---|---|
| PubChem CID | 7061910 |
| Molecular Formula | C11H10N3O3- |
| Molecular Weight | 232.22 g/mol |
| Exact Mass | 232.07 |
| IUPAC Name | 4-(4-oxo-1,2,3-benzotriazin-3-yl)butanoate |
| SMILES | O=C([O-])CCCn1nnc2ccccc2c1=O |
| InChI | InChI=1S/C11H11N3O3/c15-10(16)6-3-7-14-11(17)8-4-1-2-5-9(8)12-13-14/h1-2,4-5H,3,6-7H2,(H,15,16)/p-1 |
| InChIKey | UFCNOKFGMNKFMO-UHFFFAOYSA-M |
| XLogP | -0.68 |
| TPSA | 87.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.22 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |