C19H18N4O4 — CID 4974103
methyl 2-[4-(4-oxo-1,2,3-benzotriazin-3-yl)butanoylamino]benzoate (PubChem CID 4974103) has the molecular formula C19H18N4O4 and a molecular weight of 366.38 g/mol. Its IUPAC name is methyl 2-[4-(4-oxo-1,2,3-benzotriazin-3-yl)butanoylamino]benzoate.
| Compound Name | methyl 2-[4-(4-oxo-1,2,3-benzotriazin-3-yl)butanoylamino]benzoate |
|---|---|
| PubChem CID | 4974103 |
| Molecular Formula | C19H18N4O4 |
| Molecular Weight | 366.38 g/mol |
| Exact Mass | 366.13 |
| IUPAC Name | methyl 2-[4-(4-oxo-1,2,3-benzotriazin-3-yl)butanoylamino]benzoate |
| SMILES | COC(=O)c1ccccc1NC(=O)CCCn1nnc2ccccc2c1=O |
| InChI | InChI=1S/C19H18N4O4/c1-27-19(26)14-8-3-4-9-15(14)20-17(24)11-6-12-23-18(25)13-7-2-5-10-16(13)21-22-23/h2-5,7-10H,6,11-12H2,1H3,(H,20,24) |
| InChIKey | IZRDWGQKBHUULP-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 103.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.38 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |