C16H15N5O2 — CID 4906393
4-(4-oxo-1,2,3-benzotriazin-3-yl)-N-pyridin-2-ylbutanamide (PubChem CID 4906393) has the molecular formula C16H15N5O2 and a molecular weight of 309.33 g/mol. Its IUPAC name is 4-(4-oxo-1,2,3-benzotriazin-3-yl)-N-pyridin-2-ylbutanamide.
| Compound Name | 4-(4-oxo-1,2,3-benzotriazin-3-yl)-N-pyridin-2-ylbutanamide |
|---|---|
| PubChem CID | 4906393 |
| Molecular Formula | C16H15N5O2 |
| Molecular Weight | 309.33 g/mol |
| Exact Mass | 309.12 |
| IUPAC Name | 4-(4-oxo-1,2,3-benzotriazin-3-yl)-N-pyridin-2-ylbutanamide |
| SMILES | O=C(CCCn1nnc2ccccc2c1=O)Nc1ccccn1 |
| InChI | InChI=1S/C16H15N5O2/c22-15(18-14-8-3-4-10-17-14)9-5-11-21-16(23)12-6-1-2-7-13(12)19-20-21/h1-4,6-8,10H,5,9,11H2,(H,17,18,22) |
| InChIKey | BQGVMSSJDLITPP-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 89.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.33 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |