C19H21N5O2 — CID 45493872
6-(4-oxo-1,2,3-benzotriazin-3-yl)-N-(pyridin-2-ylmethyl)hexanamide (PubChem CID 45493872) has the molecular formula C19H21N5O2 and a molecular weight of 351.41 g/mol. Its IUPAC name is 6-(4-oxo-1,2,3-benzotriazin-3-yl)-N-(pyridin-2-ylmethyl)hexanamide.
| Compound Name | 6-(4-oxo-1,2,3-benzotriazin-3-yl)-N-(pyridin-2-ylmethyl)hexanamide |
|---|---|
| PubChem CID | 45493872 |
| Molecular Formula | C19H21N5O2 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.17 |
| IUPAC Name | 6-(4-oxo-1,2,3-benzotriazin-3-yl)-N-(pyridin-2-ylmethyl)hexanamide |
| SMILES | O=C(CCCCCn1nnc2ccccc2c1=O)NCc1ccccn1 |
| InChI | InChI=1S/C19H21N5O2/c25-18(21-14-15-8-5-6-12-20-15)11-2-1-7-13-24-19(26)16-9-3-4-10-17(16)22-23-24/h3-6,8-10,12H,1-2,7,11,13-14H2,(H,21,25) |
| InChIKey | BOXOFOGJIDXUBU-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 89.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|