C15H17N7O2 — CID 71709335
6-(4-oxo-1,2,3-benzotriazin-3-yl)-N-(1H-1,2,4-triazol-5-yl)hexanamide (PubChem CID 71709335) has the molecular formula C15H17N7O2 and a molecular weight of 327.35 g/mol. Its IUPAC name is 6-(4-oxo-1,2,3-benzotriazin-3-yl)-N-(1H-1,2,4-triazol-5-yl)hexanamide.
| Compound Name | 6-(4-oxo-1,2,3-benzotriazin-3-yl)-N-(1H-1,2,4-triazol-5-yl)hexanamide |
|---|---|
| PubChem CID | 71709335 |
| Molecular Formula | C15H17N7O2 |
| Molecular Weight | 327.35 g/mol |
| Exact Mass | 327.14 |
| IUPAC Name | 6-(4-oxo-1,2,3-benzotriazin-3-yl)-N-(1H-1,2,4-triazol-5-yl)hexanamide |
| SMILES | O=C(CCCCCn1nnc2ccccc2c1=O)Nc1ncn[nH]1 |
| InChI | InChI=1S/C15H17N7O2/c23-13(18-15-16-10-17-20-15)8-2-1-5-9-22-14(24)11-6-3-4-7-12(11)19-21-22/h3-4,6-7,10H,1-2,5,8-9H2,(H2,16,17,18,20,23) |
| InChIKey | GWFANKOVFXDNIV-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 118.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.35 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|