C20H21N5O3 — CID 4905480
2-[6-(4-oxo-1,2,3-benzotriazin-3-yl)hexanoylamino]benzamide (PubChem CID 4905480) has the molecular formula C20H21N5O3 and a molecular weight of 379.42 g/mol. Its IUPAC name is 2-[6-(4-oxo-1,2,3-benzotriazin-3-yl)hexanoylamino]benzamide.
| Compound Name | 2-[6-(4-oxo-1,2,3-benzotriazin-3-yl)hexanoylamino]benzamide |
|---|---|
| PubChem CID | 4905480 |
| Molecular Formula | C20H21N5O3 |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | 2-[6-(4-oxo-1,2,3-benzotriazin-3-yl)hexanoylamino]benzamide |
| SMILES | NC(=O)c1ccccc1NC(=O)CCCCCn1nnc2ccccc2c1=O |
| InChI | InChI=1S/C20H21N5O3/c21-19(27)14-8-3-5-10-16(14)22-18(26)12-2-1-7-13-25-20(28)15-9-4-6-11-17(15)23-24-25/h3-6,8-11H,1-2,7,12-13H2,(H2,21,27)(H,22,26) |
| InChIKey | OXPONFLOXZWOEV-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 119.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|