C19H28N4O2 — CID 143988612
N,N'-bis(pyridin-2-ylmethyl)heptanediamide;molecular hydrogen (PubChem CID 143988612) has the molecular formula C19H28N4O2 and a molecular weight of 344.46 g/mol. Its IUPAC name is N,N'-bis(pyridin-2-ylmethyl)heptanediamide;molecular hydrogen.
| Compound Name | N,N'-bis(pyridin-2-ylmethyl)heptanediamide;molecular hydrogen |
|---|---|
| PubChem CID | 143988612 |
| Molecular Formula | C19H28N4O2 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.22 |
| IUPAC Name | N,N'-bis(pyridin-2-ylmethyl)heptanediamide;molecular hydrogen |
| SMILES | O=C(CCCCCC(=O)NCc1ccccn1)NCc1ccccn1.[H][H].[H][H] |
| InChI | InChI=1S/C19H24N4O2.2H2/c24-18(22-14-16-8-4-6-12-20-16)10-2-1-3-11-19(25)23-15-17-9-5-7-13-21-17;;/h4-9,12-13H,1-3,10-11,14-15H2,(H,22,24)(H,23,25);2*1H |
| InChIKey | MQJVNRLENSAUAD-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|