C20H27N3O4 — CID 46558346
N-cyclohexyl-4-(6,7-dimethoxy-4-oxoquinazolin-3-yl)butanamide (PubChem CID 46558346) has the molecular formula C20H27N3O4 and a molecular weight of 373.45 g/mol. Its IUPAC name is N-cyclohexyl-4-(6,7-dimethoxy-4-oxoquinazolin-3-yl)butanamide.
| Compound Name | N-cyclohexyl-4-(6,7-dimethoxy-4-oxoquinazolin-3-yl)butanamide |
|---|---|
| PubChem CID | 46558346 |
| Molecular Formula | C20H27N3O4 |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.20 |
| IUPAC Name | N-cyclohexyl-4-(6,7-dimethoxy-4-oxoquinazolin-3-yl)butanamide |
| SMILES | COc1cc2ncn(CCCC(=O)NC3CCCCC3)c(=O)c2cc1OC |
| InChI | InChI=1S/C20H27N3O4/c1-26-17-11-15-16(12-18(17)27-2)21-13-23(20(15)25)10-6-9-19(24)22-14-7-4-3-5-8-14/h11-14H,3-10H2,1-2H3,(H,22,24) |
| InChIKey | IERQKSHERHUGGS-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |