C19H26N4O4 — CID 119427582
4-(6,7-dimethoxy-4-oxoquinazolin-3-yl)-N-piperidin-3-ylbutanamide (PubChem CID 119427582) has the molecular formula C19H26N4O4 and a molecular weight of 374.44 g/mol. Its IUPAC name is 4-(6,7-dimethoxy-4-oxoquinazolin-3-yl)-N-piperidin-3-ylbutanamide.
| Compound Name | 4-(6,7-dimethoxy-4-oxoquinazolin-3-yl)-N-piperidin-3-ylbutanamide |
|---|---|
| PubChem CID | 119427582 |
| Molecular Formula | C19H26N4O4 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.20 |
| IUPAC Name | 4-(6,7-dimethoxy-4-oxoquinazolin-3-yl)-N-piperidin-3-ylbutanamide |
| SMILES | COc1cc2ncn(CCCC(=O)NC3CCCNC3)c(=O)c2cc1OC |
| InChI | InChI=1S/C19H26N4O4/c1-26-16-9-14-15(10-17(16)27-2)21-12-23(19(14)25)8-4-6-18(24)22-13-5-3-7-20-11-13/h9-10,12-13,20H,3-8,11H2,1-2H3,(H,22,24) |
| InChIKey | XXESQWVSFAGYJS-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 94.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |