C28H29N3O4 — CID 46461895
4-(6,7-dimethoxy-4-oxoquinazolin-3-yl)-N-(2,2-diphenylethyl)butanamide (PubChem CID 46461895) has the molecular formula C28H29N3O4 and a molecular weight of 471.56 g/mol. Its IUPAC name is 4-(6,7-dimethoxy-4-oxoquinazolin-3-yl)-N-(2,2-diphenylethyl)butanamide.
| Compound Name | 4-(6,7-dimethoxy-4-oxoquinazolin-3-yl)-N-(2,2-diphenylethyl)butanamide |
|---|---|
| PubChem CID | 46461895 |
| Molecular Formula | C28H29N3O4 |
| Molecular Weight | 471.56 g/mol |
| Exact Mass | 471.22 |
| IUPAC Name | 4-(6,7-dimethoxy-4-oxoquinazolin-3-yl)-N-(2,2-diphenylethyl)butanamide |
| SMILES | COc1cc2ncn(CCCC(=O)NCC(c3ccccc3)c3ccccc3)c(=O)c2cc1OC |
| InChI | InChI=1S/C28H29N3O4/c1-34-25-16-22-24(17-26(25)35-2)30-19-31(28(22)33)15-9-14-27(32)29-18-23(20-10-5-3-6-11-20)21-12-7-4-8-13-21/h3-8,10-13,16-17,19,23H,9,14-15,18H2,1-2H3,(H,29,32) |
| InChIKey | LZRVVDWZQUPMKE-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.56 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |