C22H25N3O4 — CID 46657700
4-(6,7-dimethoxy-4-oxoquinazolin-3-yl)-N-(1-phenylethyl)butanamide (PubChem CID 46657700) has the molecular formula C22H25N3O4 and a molecular weight of 395.46 g/mol. Its IUPAC name is 4-(6,7-dimethoxy-4-oxoquinazolin-3-yl)-N-(1-phenylethyl)butanamide.
| Compound Name | 4-(6,7-dimethoxy-4-oxoquinazolin-3-yl)-N-(1-phenylethyl)butanamide |
|---|---|
| PubChem CID | 46657700 |
| Molecular Formula | C22H25N3O4 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.18 |
| IUPAC Name | 4-(6,7-dimethoxy-4-oxoquinazolin-3-yl)-N-(1-phenylethyl)butanamide |
| SMILES | COc1cc2ncn(CCCC(=O)NC(C)c3ccccc3)c(=O)c2cc1OC |
| InChI | InChI=1S/C22H25N3O4/c1-15(16-8-5-4-6-9-16)24-21(26)10-7-11-25-14-23-18-13-20(29-3)19(28-2)12-17(18)22(25)27/h4-6,8-9,12-15H,7,10-11H2,1-3H3,(H,24,26) |
| InChIKey | JJZCOHMYPBPHON-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |