C21H25N3O5S — CID 22422815
N-[2-(3,4-dimethoxyphenyl)ethyl]-5-(2,4-dioxo-1H-thieno[3,2-d]pyrimidin-3-yl)pentanamide (PubChem CID 22422815) has the molecular formula C21H25N3O5S and a molecular weight of 431.51 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)ethyl]-5-(2,4-dioxo-1H-thieno[3,2-d]pyrimidin-3-yl)pentanamide.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-5-(2,4-dioxo-1H-thieno[3,2-d]pyrimidin-3-yl)pentanamide |
|---|---|
| PubChem CID | 22422815 |
| Molecular Formula | C21H25N3O5S |
| Molecular Weight | 431.51 g/mol |
| Exact Mass | 431.15 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-5-(2,4-dioxo-1H-thieno[3,2-d]pyrimidin-3-yl)pentanamide |
| SMILES | COc1ccc(CCNC(=O)CCCCn2c(=O)[nH]c3ccsc3c2=O)cc1OC |
| InChI | InChI=1S/C21H25N3O5S/c1-28-16-7-6-14(13-17(16)29-2)8-10-22-18(25)5-3-4-11-24-20(26)19-15(9-12-30-19)23-21(24)27/h6-7,9,12-13H,3-5,8,10-11H2,1-2H3,(H,22,25)(H,23,27) |
| InChIKey | BTEZOKDFCPYNAQ-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 102.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.51 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|