C13H17N3O4S — CID 15987974
4-(2,4-dioxo-1H-thieno[3,2-d]pyrimidin-3-yl)-N-(2-methoxyethyl)butanamide (PubChem CID 15987974) has the molecular formula C13H17N3O4S and a molecular weight of 311.36 g/mol. Its IUPAC name is 4-(2,4-dioxo-1H-thieno[3,2-d]pyrimidin-3-yl)-N-(2-methoxyethyl)butanamide.
| Compound Name | 4-(2,4-dioxo-1H-thieno[3,2-d]pyrimidin-3-yl)-N-(2-methoxyethyl)butanamide |
|---|---|
| PubChem CID | 15987974 |
| Molecular Formula | C13H17N3O4S |
| Molecular Weight | 311.36 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | 4-(2,4-dioxo-1H-thieno[3,2-d]pyrimidin-3-yl)-N-(2-methoxyethyl)butanamide |
| SMILES | COCCNC(=O)CCCn1c(=O)[nH]c2ccsc2c1=O |
| InChI | InChI=1S/C13H17N3O4S/c1-20-7-5-14-10(17)3-2-6-16-12(18)11-9(4-8-21-11)15-13(16)19/h4,8H,2-3,5-7H2,1H3,(H,14,17)(H,15,19) |
| InChIKey | SBQQIDQOYARONJ-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 93.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.36 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|