C17H17N3O3S — CID 22422855
5-(2,4-dioxo-1H-thieno[3,2-d]pyrimidin-3-yl)-N-phenylpentanamide (PubChem CID 22422855) has the molecular formula C17H17N3O3S and a molecular weight of 343.41 g/mol. Its IUPAC name is 5-(2,4-dioxo-1H-thieno[3,2-d]pyrimidin-3-yl)-N-phenylpentanamide.
| Compound Name | 5-(2,4-dioxo-1H-thieno[3,2-d]pyrimidin-3-yl)-N-phenylpentanamide |
|---|---|
| PubChem CID | 22422855 |
| Molecular Formula | C17H17N3O3S |
| Molecular Weight | 343.41 g/mol |
| Exact Mass | 343.10 |
| IUPAC Name | 5-(2,4-dioxo-1H-thieno[3,2-d]pyrimidin-3-yl)-N-phenylpentanamide |
| SMILES | O=C(CCCCn1c(=O)[nH]c2ccsc2c1=O)Nc1ccccc1 |
| InChI | InChI=1S/C17H17N3O3S/c21-14(18-12-6-2-1-3-7-12)8-4-5-10-20-16(22)15-13(9-11-24-15)19-17(20)23/h1-3,6-7,9,11H,4-5,8,10H2,(H,18,21)(H,19,23) |
| InChIKey | DSCUOEQSCOLVLW-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 83.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.41 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|