C13H10N2O2S — CID 56686605
3-benzyl-1H-thieno[3,2-d]pyrimidine-2,4-dione (PubChem CID 56686605) has the molecular formula C13H10N2O2S and a molecular weight of 258.30 g/mol. Its IUPAC name is 3-benzyl-1H-thieno[3,2-d]pyrimidine-2,4-dione.
| Compound Name | 3-benzyl-1H-thieno[3,2-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 56686605 |
| Molecular Formula | C13H10N2O2S |
| Molecular Weight | 258.30 g/mol |
| Exact Mass | 258.05 |
| IUPAC Name | 3-benzyl-1H-thieno[3,2-d]pyrimidine-2,4-dione |
| SMILES | O=c1[nH]c2ccsc2c(=O)n1Cc1ccccc1 |
| InChI | InChI=1S/C13H10N2O2S/c16-12-11-10(6-7-18-11)14-13(17)15(12)8-9-4-2-1-3-5-9/h1-7H,8H2,(H,14,17) |
| InChIKey | ZKKPXEWWIAZFRG-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 54.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.30 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |