C14H12N2O2S — CID 143665036
3-benzyl-6-methyl-1H-thieno[3,2-d]pyrimidine-2,4-dione (PubChem CID 143665036) has the molecular formula C14H12N2O2S and a molecular weight of 272.33 g/mol. Its IUPAC name is 3-benzyl-6-methyl-1H-thieno[3,2-d]pyrimidine-2,4-dione.
| Compound Name | 3-benzyl-6-methyl-1H-thieno[3,2-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 143665036 |
| Molecular Formula | C14H12N2O2S |
| Molecular Weight | 272.33 g/mol |
| Exact Mass | 272.06 |
| IUPAC Name | 3-benzyl-6-methyl-1H-thieno[3,2-d]pyrimidine-2,4-dione |
| SMILES | Cc1cc2[nH]c(=O)n(Cc3ccccc3)c(=O)c2s1 |
| InChI | InChI=1S/C14H12N2O2S/c1-9-7-11-12(19-9)13(17)16(14(18)15-11)8-10-5-3-2-4-6-10/h2-7H,8H2,1H3,(H,15,18) |
| InChIKey | ITMAYJAMFSHCBY-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 54.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.33 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |