C9H9ClN2O2S — CID 170981691
6-(chloromethyl)-3-ethyl-1H-thieno[3,2-d]pyrimidine-2,4-dione (PubChem CID 170981691) has the molecular formula C9H9ClN2O2S and a molecular weight of 244.70 g/mol. Its IUPAC name is 6-(chloromethyl)-3-ethyl-1H-thieno[3,2-d]pyrimidine-2,4-dione.
| Compound Name | 6-(chloromethyl)-3-ethyl-1H-thieno[3,2-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 170981691 |
| Molecular Formula | C9H9ClN2O2S |
| Molecular Weight | 244.70 g/mol |
| Exact Mass | 244.01 |
| IUPAC Name | 6-(chloromethyl)-3-ethyl-1H-thieno[3,2-d]pyrimidine-2,4-dione |
| SMILES | CCn1c(=O)[nH]c2cc(CCl)sc2c1=O |
| InChI | InChI=1S/C9H9ClN2O2S/c1-2-12-8(13)7-6(11-9(12)14)3-5(4-10)15-7/h3H,2,4H2,1H3,(H,11,14) |
| InChIKey | NJOMSXNVTRFKQT-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 54.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.70 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|