C10H9N3O4 — CID 115587409
3-ethyl-6-nitro-1H-quinazoline-2,4-dione (PubChem CID 115587409) has the molecular formula C10H9N3O4 and a molecular weight of 235.20 g/mol. Its IUPAC name is 3-ethyl-6-nitro-1H-quinazoline-2,4-dione.
| Compound Name | 3-ethyl-6-nitro-1H-quinazoline-2,4-dione |
|---|---|
| PubChem CID | 115587409 |
| Molecular Formula | C10H9N3O4 |
| Molecular Weight | 235.20 g/mol |
| Exact Mass | 235.06 |
| IUPAC Name | 3-ethyl-6-nitro-1H-quinazoline-2,4-dione |
| SMILES | CCn1c(=O)[nH]c2ccc([N+](=O)[O-])cc2c1=O |
| InChI | InChI=1S/C10H9N3O4/c1-2-12-9(14)7-5-6(13(16)17)3-4-8(7)11-10(12)15/h3-5H,2H2,1H3,(H,11,15) |
| InChIKey | NPOSQSCBKAPVFT-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 98.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.20 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|