C12H8N4O4 — CID 19074506
1-amino-9-nitro-4H-benzo[f]quinoxaline-2,3-dione (PubChem CID 19074506) has the molecular formula C12H8N4O4 and a molecular weight of 272.22 g/mol. Its IUPAC name is 1-amino-9-nitro-4H-benzo[f]quinoxaline-2,3-dione.
| Compound Name | 1-amino-9-nitro-4H-benzo[f]quinoxaline-2,3-dione |
|---|---|
| PubChem CID | 19074506 |
| Molecular Formula | C12H8N4O4 |
| Molecular Weight | 272.22 g/mol |
| Exact Mass | 272.05 |
| IUPAC Name | 1-amino-9-nitro-4H-benzo[f]quinoxaline-2,3-dione |
| SMILES | Nn1c(=O)c(=O)[nH]c2ccc3ccc([N+](=O)[O-])cc3c21 |
| InChI | InChI=1S/C12H8N4O4/c13-15-10-8-5-7(16(19)20)3-1-6(8)2-4-9(10)14-11(17)12(15)18/h1-5H,13H2,(H,14,17) |
| InChIKey | RBABRLZGDZKJKO-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 124.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.22 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|