C9H5N3O6 — CID 54696471
4-hydroxy-3,6-dinitro-1H-quinolin-2-one (PubChem CID 54696471) has the molecular formula C9H5N3O6 and a molecular weight of 251.15 g/mol. Its IUPAC name is 4-hydroxy-3,6-dinitro-1H-quinolin-2-one.
| Compound Name | 4-hydroxy-3,6-dinitro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 54696471 |
| Molecular Formula | C9H5N3O6 |
| Molecular Weight | 251.15 g/mol |
| Exact Mass | 251.02 |
| IUPAC Name | 4-hydroxy-3,6-dinitro-1H-quinolin-2-one |
| SMILES | O=c1[nH]c2ccc([N+](=O)[O-])cc2c(O)c1[N+](=O)[O-] |
| InChI | InChI=1S/C9H5N3O6/c13-8-5-3-4(11(15)16)1-2-6(5)10-9(14)7(8)12(17)18/h1-3H,(H2,10,13,14) |
| InChIKey | QGHNFWHYFACJLP-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 139.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.15 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|