C20H16Br2Cl2N4O6 — CID 165029211
6-bromo-2,4-dichloro-3-nitroquinoline;6-bromo-4-hydroxy-3-nitro-1H-quinolin-2-one;methane (PubChem CID 165029211) has the molecular formula C20H16Br2Cl2N4O6 and a molecular weight of 639.08 g/mol. Its IUPAC name is 6-bromo-2,4-dichloro-3-nitroquinoline;6-bromo-4-hydroxy-3-nitro-1H-quinolin-2-one;methane.
| Compound Name | 6-bromo-2,4-dichloro-3-nitroquinoline;6-bromo-4-hydroxy-3-nitro-1H-quinolin-2-one;methane |
|---|---|
| PubChem CID | 165029211 |
| Molecular Formula | C20H16Br2Cl2N4O6 |
| Molecular Weight | 639.08 g/mol |
| Exact Mass | 635.88 |
| IUPAC Name | 6-bromo-2,4-dichloro-3-nitroquinoline;6-bromo-4-hydroxy-3-nitro-1H-quinolin-2-one;methane |
| SMILES | C.C.O=[N+]([O-])c1c(Cl)nc2ccc(Br)cc2c1Cl.O=c1[nH]c2ccc(Br)cc2c(O)c1[N+](=O)[O-] |
| InChI | InChI=1S/C9H3BrCl2N2O2.C9H5BrN2O4.2CH4/c10-4-1-2-6-5(3-4)7(11)8(14(15)16)9(12)13-6;10-4-1-2-6-5(3-4)8(13)7(12(15)16)9(14)11-6;;/h1-3H;1-3H,(H2,11,13,14);2*1H4 |
| InChIKey | MJKLFJNXFSGXOJ-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 152.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.08 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|