C22H20ClN5O6 — CID 159729551
2-chloro-N-(2-methylpropyl)-3-nitroquinolin-4-amine;4-hydroxy-3-nitro-1H-quinolin-2-one (PubChem CID 159729551) has the molecular formula C22H20ClN5O6 and a molecular weight of 485.88 g/mol. Its IUPAC name is 2-chloro-N-(2-methylpropyl)-3-nitroquinolin-4-amine;4-hydroxy-3-nitro-1H-quinolin-2-one.
| Compound Name | 2-chloro-N-(2-methylpropyl)-3-nitroquinolin-4-amine;4-hydroxy-3-nitro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 159729551 |
| Molecular Formula | C22H20ClN5O6 |
| Molecular Weight | 485.88 g/mol |
| Exact Mass | 485.11 |
| IUPAC Name | 2-chloro-N-(2-methylpropyl)-3-nitroquinolin-4-amine;4-hydroxy-3-nitro-1H-quinolin-2-one |
| SMILES | CC(C)CNc1c([N+](=O)[O-])c(Cl)nc2ccccc12.O=c1[nH]c2ccccc2c(O)c1[N+](=O)[O-] |
| InChI | InChI=1S/C13H14ClN3O2.C9H6N2O4/c1-8(2)7-15-11-9-5-3-4-6-10(9)16-13(14)12(11)17(18)19;12-8-5-3-1-2-4-6(5)10-9(13)7(8)11(14)15/h3-6,8H,7H2,1-2H3,(H,15,16);1-4H,(H2,10,12,13) |
| InChIKey | NBBJMWKAGOWCRS-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 164.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.88 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|