C19H23ClN4O4 — CID 177290893
tert-butyl N-[(E)-4-[(2-chloro-3-nitroquinolin-4-yl)amino]-3-methylbut-2-enyl]carbamate (PubChem CID 177290893) has the molecular formula C19H23ClN4O4 and a molecular weight of 406.87 g/mol. Its IUPAC name is tert-butyl N-[(E)-4-[(2-chloro-3-nitroquinolin-4-yl)amino]-3-methylbut-2-enyl]carbamate.
| Compound Name | tert-butyl N-[(E)-4-[(2-chloro-3-nitroquinolin-4-yl)amino]-3-methylbut-2-enyl]carbamate |
|---|---|
| PubChem CID | 177290893 |
| Molecular Formula | C19H23ClN4O4 |
| Molecular Weight | 406.87 g/mol |
| Exact Mass | 406.14 |
| IUPAC Name | tert-butyl N-[(E)-4-[(2-chloro-3-nitroquinolin-4-yl)amino]-3-methylbut-2-enyl]carbamate |
| SMILES | C/C(=C\CNC(=O)OC(C)(C)C)CNc1c([N+](=O)[O-])c(Cl)nc2ccccc12 |
| InChI | InChI=1S/C19H23ClN4O4/c1-12(9-10-21-18(25)28-19(2,3)4)11-22-15-13-7-5-6-8-14(13)23-17(20)16(15)24(26)27/h5-9H,10-11H2,1-4H3,(H,21,25)(H,22,23)/b12-9+ |
| InChIKey | PZHZFCKUOPNBPH-FMIVXFBMSA-N |
| XLogP | 4.68 |
| TPSA | 106.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.87 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|